Lyxose
| Lyxose | |
|---|---|
| IUPAC name | (2R,3R,4S)-2,3,4,5-Tetrahydroxypentanal |
| Other names | L-Lyxose Lyxopyranose |
| Identifiers | |
| CAS number | [1949-78-6] |
| PubChem | |
| SMILES | C([C@@H]([C@H]([C@H](C=O)O)O)O)O |
| Properties | |
| Molecular formula | C5H10O5 |
| Molar mass | 150.13 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Lyxose is an aldopentose — a monosaccharide containing five carbon atoms, and including an aldehyde functional group. It has chemical formula C5H10O5.
Lyxose occurs only rarely in nature; for example, as a component of bacterial glycolipids.[1]
Contents |
Isomers
References
See also
External links
E. coli K-12 Pathway: L-lyxose degradation
|
||||||||||||||||||||||||||||||||||||||